C14H17N5OS — CID 91763567
N-methyl-2-methylsulfanyl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidine-5-carboxamide (PubChem CID 91763567) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is N-methyl-2-methylsulfanyl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidine-5-carboxamide.
| Compound Name | N-methyl-2-methylsulfanyl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91763567 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-methyl-2-methylsulfanyl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)N(C)C(C)Cc2cnccn2)cn1 |
| InChI | InChI=1S/C14H17N5OS/c1-10(6-12-9-15-4-5-16-12)19(2)13(20)11-7-17-14(21-3)18-8-11/h4-5,7-10H,6H2,1-3H3 |
| InChIKey | ISKWNAVTCSDWIU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |