C19H22N2O2S — CID 124852475
[(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3-(2-methyl-1,3-thiazol-4-yl)benzoate (PubChem CID 124852475) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is [(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3-(2-methyl-1,3-thiazol-4-yl)benzoate.
| Compound Name | [(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3-(2-methyl-1,3-thiazol-4-yl)benzoate |
|---|---|
| PubChem CID | 124852475 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] 3-(2-methyl-1,3-thiazol-4-yl)benzoate |
| SMILES | Cc1nc(-c2cccc(C(=O)O[C@@H]3CCN4CCC[C@H]4C3)c2)cs1 |
| InChI | InChI=1S/C19H22N2O2S/c1-13-20-18(12-24-13)14-4-2-5-15(10-14)19(22)23-17-7-9-21-8-3-6-16(21)11-17/h2,4-5,10,12,16-17H,3,6-9,11H2,1H3/t16-,17+/m0/s1 |
| InChIKey | UWDUJTYKGHHOSE-DLBZAZTESA-N |
| XLogP | 3.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |