C19H27N5O — CID 124852589
1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-3-[(1S,2R)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 124852589) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-3-[(1S,2R)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-3-[(1S,2R)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 124852589 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-3-[(1S,2R)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | Cc1ccc2c(c1)[C@@H](NC(=O)NCc1ncnn1C(C)(C)C)[C@H](C)C2 |
| InChI | InChI=1S/C19H27N5O/c1-12-6-7-14-9-13(2)17(15(14)8-12)23-18(25)20-10-16-21-11-22-24(16)19(3,4)5/h6-8,11,13,17H,9-10H2,1-5H3,(H2,20,23,25)/t13-,17+/m1/s1 |
| InChIKey | VEDJESQDCIUSFX-DYVFJYSZSA-N |
| XLogP | 3.07 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |