C17H22N4OS — CID 99821232
N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 99821232) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 99821232 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | Cc1ccc2c(c1)[C@H](NC(=O)CCSc1n[nH]c(C)n1)[C@@H](C)C2 |
| InChI | InChI=1S/C17H22N4OS/c1-10-4-5-13-9-11(2)16(14(13)8-10)19-15(22)6-7-23-17-18-12(3)20-21-17/h4-5,8,11,16H,6-7,9H2,1-3H3,(H,19,22)(H,18,20,21)/t11-,16+/m0/s1 |
| InChIKey | SDBWUJMGCZABAE-MEDUHNTESA-N |
| XLogP | 2.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |