C17H24ClN5O — CID 124852743
1-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]urea (PubChem CID 124852743) has the molecular formula C17H24ClN5O and a molecular weight of 349.87 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]urea.
| Compound Name | 1-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 124852743 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]urea |
| SMILES | Cc1cnn(CCNC(=O)N[C@H](CN(C)C)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H24ClN5O/c1-13-10-20-23(11-13)9-8-19-17(24)21-16(12-22(2)3)14-4-6-15(18)7-5-14/h4-7,10-11,16H,8-9,12H2,1-3H3,(H2,19,21,24)/t16-/m1/s1 |
| InChIKey | VHVWFAPONHFYTI-MRXNPFEDSA-N |
| XLogP | 2.45 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |