C15H18ClN5O — CID 125141657
1-[(1R)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-pyrimidin-4-ylurea (PubChem CID 125141657) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is 1-[(1R)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-pyrimidin-4-ylurea.
| Compound Name | 1-[(1R)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-pyrimidin-4-ylurea |
|---|---|
| PubChem CID | 125141657 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[(1R)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-pyrimidin-4-ylurea |
| SMILES | CN(C)C[C@H](NC(=O)Nc1ccncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClN5O/c1-21(2)9-13(11-3-5-12(16)6-4-11)19-15(22)20-14-7-8-17-10-18-14/h3-8,10,13H,9H2,1-2H3,(H2,17,18,19,20,22)/t13-/m0/s1 |
| InChIKey | UDPZXXOBQYSWBH-ZDUSSCGKSA-N |
| XLogP | 2.55 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |