C19H22Cl2FN3O — CID 167941647
1-[1-(4-chloro-3-fluorophenyl)ethyl]-3-[1-(4-chlorophenyl)-2-(dimethylamino)ethyl]urea (PubChem CID 167941647) has the molecular formula C19H22Cl2FN3O and a molecular weight of 398.31 g/mol. Its IUPAC name is 1-[1-(4-chloro-3-fluorophenyl)ethyl]-3-[1-(4-chlorophenyl)-2-(dimethylamino)ethyl]urea.
| Compound Name | 1-[1-(4-chloro-3-fluorophenyl)ethyl]-3-[1-(4-chlorophenyl)-2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 167941647 |
| Molecular Formula | C19H22Cl2FN3O |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-[1-(4-chloro-3-fluorophenyl)ethyl]-3-[1-(4-chlorophenyl)-2-(dimethylamino)ethyl]urea |
| SMILES | CC(NC(=O)NC(CN(C)C)c1ccc(Cl)cc1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H22Cl2FN3O/c1-12(14-6-9-16(21)17(22)10-14)23-19(26)24-18(11-25(2)3)13-4-7-15(20)8-5-13/h4-10,12,18H,11H2,1-3H3,(H2,23,24,26) |
| InChIKey | ZUOYRQAZCHWACQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |