C19H18N2O4 — CID 124853278
2-[(2R)-1-(dibenzofuran-4-ylmethyl)-3-oxopiperazin-2-yl]acetic acid (PubChem CID 124853278) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[(2R)-1-(dibenzofuran-4-ylmethyl)-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-1-(dibenzofuran-4-ylmethyl)-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 124853278 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[(2R)-1-(dibenzofuran-4-ylmethyl)-3-oxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1C(=O)NCCN1Cc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C19H18N2O4/c22-17(23)10-15-19(24)20-8-9-21(15)11-12-4-3-6-14-13-5-1-2-7-16(13)25-18(12)14/h1-7,15H,8-11H2,(H,20,24)(H,22,23)/t15-/m1/s1 |
| InChIKey | VRZNSCWWFWOBPD-OAHLLOKOSA-N |
| XLogP | 2.36 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |