C17H18N2O4S — CID 124854798
7-[[3-[(1S)-1-methoxyethyl]-1,2,4-thiadiazol-5-yl]oxy]-4-propan-2-ylchromen-2-one (PubChem CID 124854798) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 7-[[3-[(1S)-1-methoxyethyl]-1,2,4-thiadiazol-5-yl]oxy]-4-propan-2-ylchromen-2-one.
| Compound Name | 7-[[3-[(1S)-1-methoxyethyl]-1,2,4-thiadiazol-5-yl]oxy]-4-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 124854798 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 7-[[3-[(1S)-1-methoxyethyl]-1,2,4-thiadiazol-5-yl]oxy]-4-propan-2-ylchromen-2-one |
| SMILES | CO[C@@H](C)c1nsc(Oc2ccc3c(C(C)C)cc(=O)oc3c2)n1 |
| InChI | InChI=1S/C17H18N2O4S/c1-9(2)13-8-15(20)23-14-7-11(5-6-12(13)14)22-17-18-16(19-24-17)10(3)21-4/h5-10H,1-4H3/t10-/m0/s1 |
| InChIKey | XWQDYIJHEOODCS-JTQLQIEISA-N |
| XLogP | 4.27 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|