C18H24N2O3 — CID 124855091
(2R)-2-(1,3-benzodioxol-5-yl)-N-(cyclohexen-1-ylmethyl)-2-(dimethylamino)acetamide (PubChem CID 124855091) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-5-yl)-N-(cyclohexen-1-ylmethyl)-2-(dimethylamino)acetamide.
| Compound Name | (2R)-2-(1,3-benzodioxol-5-yl)-N-(cyclohexen-1-ylmethyl)-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 124855091 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-5-yl)-N-(cyclohexen-1-ylmethyl)-2-(dimethylamino)acetamide |
| SMILES | CN(C)[C@@H](C(=O)NCC1=CCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H24N2O3/c1-20(2)17(14-8-9-15-16(10-14)23-12-22-15)18(21)19-11-13-6-4-3-5-7-13/h6,8-10,17H,3-5,7,11-12H2,1-2H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | YOBWFIRAIUAINA-QGZVFWFLSA-N |
| XLogP | 2.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|