C20H26N4O3 — CID 91830482
2-(1,3-benzodioxol-5-yl)-N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-2-(dimethylamino)acetamide (PubChem CID 91830482) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-2-(dimethylamino)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 91830482 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)C(C(=O)NCCCn1nccc1C1CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H26N4O3/c1-23(2)19(15-6-7-17-18(12-15)27-13-26-17)20(25)21-9-3-11-24-16(8-10-22-24)14-4-5-14/h6-8,10,12,14,19H,3-5,9,11,13H2,1-2H3,(H,21,25) |
| InChIKey | PHEOIOFYTBXPGO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|