C24H27F3N2O3 — CID 124855999
(3aR,4R,5R,7aS)-4-(4-benzylpiperidine-1-carbonyl)-5-methyl-2-(2,2,2-trifluoroethyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 124855999) has the molecular formula C24H27F3N2O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is (3aR,4R,5R,7aS)-4-(4-benzylpiperidine-1-carbonyl)-5-methyl-2-(2,2,2-trifluoroethyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,5R,7aS)-4-(4-benzylpiperidine-1-carbonyl)-5-methyl-2-(2,2,2-trifluoroethyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124855999 |
| Molecular Formula | C24H27F3N2O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (3aR,4R,5R,7aS)-4-(4-benzylpiperidine-1-carbonyl)-5-methyl-2-(2,2,2-trifluoroethyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C[C@@H]1C=C[C@@H]2C(=O)N(CC(F)(F)F)C(=O)[C@H]2[C@@H]1C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H27F3N2O3/c1-15-7-8-18-20(23(32)29(21(18)30)14-24(25,26)27)19(15)22(31)28-11-9-17(10-12-28)13-16-5-3-2-4-6-16/h2-8,15,17-20H,9-14H2,1H3/t15-,18+,19-,20-/m1/s1 |
| InChIKey | DNSYTAUTIOVKHF-XWPNQZOQSA-N |
| XLogP | 3.45 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|