C21H33N3O — CID 124856842
(7S,8aR)-N-[[(2S,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 124856842) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is (7S,8aR)-N-[[(2S,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | (7S,8aR)-N-[[(2S,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 124856842 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (7S,8aR)-N-[[(2S,3S)-2-(4-methoxyphenyl)-1-methylpyrrolidin-3-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | COc1ccc([C@@H]2[C@H](CN[C@H]3CCN4CCC[C@@H]4C3)CCN2C)cc1 |
| InChI | InChI=1S/C21H33N3O/c1-23-12-9-17(21(23)16-5-7-20(25-2)8-6-16)15-22-18-10-13-24-11-3-4-19(24)14-18/h5-8,17-19,21-22H,3-4,9-15H2,1-2H3/t17-,18-,19+,21+/m0/s1 |
| InChIKey | TVPTYXXBEDNAAS-CTAFRAEOSA-N |
| XLogP | 2.90 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |