C18H28N2O — CID 129421879
(7R,8aS)-N-[3-(3-methoxyphenyl)propyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 129421879) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is (7R,8aS)-N-[3-(3-methoxyphenyl)propyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | (7R,8aS)-N-[3-(3-methoxyphenyl)propyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 129421879 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (7R,8aS)-N-[3-(3-methoxyphenyl)propyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | COc1cccc(CCCN[C@@H]2CCN3CCC[C@H]3C2)c1 |
| InChI | InChI=1S/C18H28N2O/c1-21-18-8-2-5-15(13-18)6-3-10-19-16-9-12-20-11-4-7-17(20)14-16/h2,5,8,13,16-17,19H,3-4,6-7,9-12,14H2,1H3/t16-,17+/m1/s1 |
| InChIKey | DQHPUMSWRXQKSJ-SJORKVTESA-N |
| XLogP | 2.84 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|