C20H33BrN2O2 — CID 124857570
N-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-2-[(2R)-2-[(1R)-1-hydroxyethyl]piperidin-1-yl]acetamide (PubChem CID 124857570) has the molecular formula C20H33BrN2O2 and a molecular weight of 413.40 g/mol. Its IUPAC name is N-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-2-[(2R)-2-[(1R)-1-hydroxyethyl]piperidin-1-yl]acetamide.
| Compound Name | N-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-2-[(2R)-2-[(1R)-1-hydroxyethyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124857570 |
| Molecular Formula | C20H33BrN2O2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-2-[(2R)-2-[(1R)-1-hydroxyethyl]piperidin-1-yl]acetamide |
| SMILES | C[C@@H](O)[C@H]1CCCCN1CC(=O)NCC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C20H33BrN2O2/c1-14(24)17-4-2-3-5-23(17)11-18(25)22-13-19-7-15-6-16(8-19)10-20(21,9-15)12-19/h14-17,24H,2-13H2,1H3,(H,22,25)/t14-,15-,16-,17-,19?,20?/m1/s1 |
| InChIKey | FHHNKFTWOOIZJQ-AEYPOQCISA-N |
| XLogP | 3.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|