C18H23N3O4 — CID 124858580
3-(3,4-dimethoxyphenyl)-N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,2,4-oxadiazol-5-amine (PubChem CID 124858580) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 124858580 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,2,4-oxadiazol-5-amine |
| SMILES | COc1ccc(-c2noc(N[C@@H]3[C@H]4CCO[C@H]4C3(C)C)n2)cc1OC |
| InChI | InChI=1S/C18H23N3O4/c1-18(2)14(11-7-8-24-15(11)18)19-17-20-16(21-25-17)10-5-6-12(22-3)13(9-10)23-4/h5-6,9,11,14-15H,7-8H2,1-4H3,(H,19,20,21)/t11-,14-,15-/m1/s1 |
| InChIKey | PWTZIQMXVDLSSP-KCPJHIHWSA-N |
| XLogP | 2.98 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |