C18H33N3O — CID 124858819
(3R,8aS)-N-[(1S,2R)-2-butylcyclopentyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 124858819) has the molecular formula C18H33N3O and a molecular weight of 307.48 g/mol. Its IUPAC name is (3R,8aS)-N-[(1S,2R)-2-butylcyclopentyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (3R,8aS)-N-[(1S,2R)-2-butylcyclopentyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 124858819 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | (3R,8aS)-N-[(1S,2R)-2-butylcyclopentyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CCCC[C@@H]1CCC[C@@H]1NC(=O)N1C[C@@H]2CCCN2C[C@H]1C |
| InChI | InChI=1S/C18H33N3O/c1-3-4-7-15-8-5-10-17(15)19-18(22)21-13-16-9-6-11-20(16)12-14(21)2/h14-17H,3-13H2,1-2H3,(H,19,22)/t14-,15-,16+,17+/m1/s1 |
| InChIKey | SCXSFUMYDBEPIL-NCOADZHNSA-N |
| XLogP | 3.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |