C14H25NO — CID 95244402
N-[(1S,2S)-2-butylcyclopentyl]-3-methylbut-2-enamide (PubChem CID 95244402) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[(1S,2S)-2-butylcyclopentyl]-3-methylbut-2-enamide.
| Compound Name | N-[(1S,2S)-2-butylcyclopentyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 95244402 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-[(1S,2S)-2-butylcyclopentyl]-3-methylbut-2-enamide |
| SMILES | CCCC[C@H]1CCC[C@@H]1NC(=O)C=C(C)C |
| InChI | InChI=1S/C14H25NO/c1-4-5-7-12-8-6-9-13(12)15-14(16)10-11(2)3/h10,12-13H,4-9H2,1-3H3,(H,15,16)/t12-,13-/m0/s1 |
| InChIKey | ZTGSKHYTHZIEKZ-STQMWFEESA-N |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|