About 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol
2-butyl-N-methylcyclohexan-1-amine;propan-1-ol (PubChem CID 71071796) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol.
Molecular Properties
| Compound Name | 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol |
| PubChem CID | 71071796 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol |
| SMILES | CCCCC1CCCCC1NC.CCCO |
| InChI | InChI=1S/C11H23N.C3H8O/c1-3-4-7-10-8-5-6-9-11(10)12-2;1-2-3-4/h10-12H,3-9H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | GGPKAEMLBGTZSF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol?
The IUPAC name of 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol (CID 71071796) is 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol.
What is the SMILES notation for 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol?
The canonical SMILES for 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol is CCCCC1CCCCC1NC.CCCO.
What is the InChIKey of 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol?
The InChIKey is GGPKAEMLBGTZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.C3H8O/c1-3-4-7-10-8-5-6-9-11(10)12-2;1-2-3-4/h10-12H,3-9H2,1-2H3;4H,2-3H2,1H3.
What are the key properties of 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol?
2-butyl-N-methylcyclohexan-1-amine;propan-1-ol has a molecular weight of 229.41 g/mol, XLogP of 3.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-N-methylcyclohexan-1-amine;propan-1-ol is sourced from PubChem (CID 71071796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).