C15H24N2O2 — CID 124858946
(3R)-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-3-pyrrol-1-ylbutanamide (PubChem CID 124858946) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3R)-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-3-pyrrol-1-ylbutanamide.
| Compound Name | (3R)-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-3-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 124858946 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (3R)-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-3-pyrrol-1-ylbutanamide |
| SMILES | C[C@H](CC(=O)NC[C@@H]1CCCC[C@H]1O)n1cccc1 |
| InChI | InChI=1S/C15H24N2O2/c1-12(17-8-4-5-9-17)10-15(19)16-11-13-6-2-3-7-14(13)18/h4-5,8-9,12-14,18H,2-3,6-7,10-11H2,1H3,(H,16,19)/t12-,13+,14-/m1/s1 |
| InChIKey | SSNHQMSAOQDMMU-HZSPNIEDSA-N |
| XLogP | 2.11 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |