C16H18N2O3 — CID 124860159
(2R)-2-(2,5-dioxopyrrolidin-1-yl)-N-[(1S,2S)-2-phenylcyclopropyl]propanamide (PubChem CID 124860159) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R)-2-(2,5-dioxopyrrolidin-1-yl)-N-[(1S,2S)-2-phenylcyclopropyl]propanamide.
| Compound Name | (2R)-2-(2,5-dioxopyrrolidin-1-yl)-N-[(1S,2S)-2-phenylcyclopropyl]propanamide |
|---|---|
| PubChem CID | 124860159 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2R)-2-(2,5-dioxopyrrolidin-1-yl)-N-[(1S,2S)-2-phenylcyclopropyl]propanamide |
| SMILES | C[C@H](C(=O)N[C@H]1C[C@H]1c1ccccc1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C16H18N2O3/c1-10(18-14(19)7-8-15(18)20)16(21)17-13-9-12(13)11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3,(H,17,21)/t10-,12+,13+/m1/s1 |
| InChIKey | XZQHPJXWUXWQLJ-WXHSDQCUSA-N |
| XLogP | 1.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|