C19H28N4O — CID 124860249
[4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 124860249) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is [4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 124860249 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | [4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | CC1=CCC[C@H](C)[C@H]1CNC1CCN(C(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C19H28N4O/c1-14-4-3-5-15(2)17(14)12-22-16-6-10-23(11-7-16)19(24)18-13-20-8-9-21-18/h4,8-9,13,15-17,22H,3,5-7,10-12H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | AQQDEGWMFORTGX-RDJZCZTQSA-N |
| XLogP | 2.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|