C19H34N2O — CID 99832564
1-[4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-3-methylbutan-1-one (PubChem CID 99832564) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-[4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 99832564 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 1-[4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC1=CCC[C@H](C)[C@H]1CNC1CCN(C(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C19H34N2O/c1-14(2)12-19(22)21-10-8-17(9-11-21)20-13-18-15(3)6-5-7-16(18)4/h6,14,16-18,20H,5,7-13H2,1-4H3/t16-,18-/m0/s1 |
| InChIKey | QJYXBDCTBAXQDV-WMZOPIPTSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|