C17H26N2O2 — CID 124862264
cis-(1R,2S)-2-[[(1S)-1-(2-hydroxyphenyl)propyl]amino]-N-methylcyclohexane-1-carboxamide (PubChem CID 124862264) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[(1S)-1-(2-hydroxyphenyl)propyl]amino]-N-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-[[(1S)-1-(2-hydroxyphenyl)propyl]amino]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 124862264 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | cis-(1R,2S)-2-[[(1S)-1-(2-hydroxyphenyl)propyl]amino]-N-methylcyclohexane-1-carboxamide |
| SMILES | CC[C@H](N[C@H]1CCCC[C@H]1C(=O)NC)c1ccccc1O |
| InChI | InChI=1S/C17H26N2O2/c1-3-14(12-8-5-7-11-16(12)20)19-15-10-6-4-9-13(15)17(21)18-2/h5,7-8,11,13-15,19-20H,3-4,6,9-10H2,1-2H3,(H,18,21)/t13-,14+,15+/m1/s1 |
| InChIKey | MEGVWQYWCCYYOG-ILXRZTDVSA-N |
| XLogP | 2.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|