C16H21N3O4 — CID 124865190
[(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-hydroxy-4-nitrophenyl)methanone (PubChem CID 124865190) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is [(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-hydroxy-4-nitrophenyl)methanone.
| Compound Name | [(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-hydroxy-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 124865190 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | [(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-hydroxy-4-nitrophenyl)methanone |
| SMILES | CC[C@@H]1CN2CCC[C@H]2CN1C(=O)c1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C16H21N3O4/c1-2-11-9-17-7-3-4-13(17)10-18(11)16(21)14-6-5-12(19(22)23)8-15(14)20/h5-6,8,11,13,20H,2-4,7,9-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | XWYDDLVIRDDWFG-YPMHNXCESA-N |
| XLogP | 2.00 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|