C27H38N2O4 — CID 124867277
(3R,3aR,4aR,5R,8aR,9aR)-3-[[(3R)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 124867277) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is (3R,3aR,4aR,5R,8aR,9aR)-3-[[(3R)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3R,3aR,4aR,5R,8aR,9aR)-3-[[(3R)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 124867277 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (3R,3aR,4aR,5R,8aR,9aR)-3-[[(3R)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | COc1cccc(N2CCN(C[C@@H]3C(=O)O[C@@H]4C[C@@]5(C)CCC[C@]6(CO6)[C@@H]5C[C@H]34)C[C@H]2C)c1 |
| InChI | InChI=1S/C27H38N2O4/c1-18-15-28(10-11-29(18)19-6-4-7-20(12-19)31-3)16-22-21-13-24-26(2,14-23(21)33-25(22)30)8-5-9-27(24)17-32-27/h4,6-7,12,18,21-24H,5,8-11,13-17H2,1-3H3/t18-,21-,22+,23-,24-,26-,27+/m1/s1 |
| InChIKey | BHDFYQPSESKSJM-CUQLHPEISA-N |
| XLogP | 3.73 |
| TPSA | 54.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|