C32H39ClN2O3 — CID 163078009
(3S,3aS,4aR,5S,8aR,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 163078009) has the molecular formula C32H39ClN2O3 and a molecular weight of 535.13 g/mol. Its IUPAC name is (3S,3aS,4aR,5S,8aR,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3S,3aS,4aR,5S,8aR,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 163078009 |
| Molecular Formula | C32H39ClN2O3 |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (3S,3aS,4aR,5S,8aR,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | C[C@]12CCC[C@@]3(CO3)[C@@H]1C[C@@H]1[C@@H](C2)OC(=O)[C@@H]1CN1CCN([C@@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C32H39ClN2O3/c1-31-12-5-13-32(21-37-32)28(31)18-25-26(30(36)38-27(25)19-31)20-34-14-16-35(17-15-34)29(22-6-3-2-4-7-22)23-8-10-24(33)11-9-23/h2-4,6-11,25-29H,5,12-21H2,1H3/t25-,26+,27+,28+,29-,31+,32+/m0/s1 |
| InChIKey | YFSJFJGUSDZTSP-UORCBHBNSA-N |
| XLogP | 5.57 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|