C26H34ClNO4 — CID 163068971
(3S,3aS,4aS,5S,8aR,9aR)-3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 163068971) has the molecular formula C26H34ClNO4 and a molecular weight of 460.01 g/mol. Its IUPAC name is (3S,3aS,4aS,5S,8aR,9aR)-3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3S,3aS,4aS,5S,8aR,9aR)-3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 163068971 |
| Molecular Formula | C26H34ClNO4 |
| Molecular Weight | 460.01 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (3S,3aS,4aS,5S,8aR,9aR)-3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | C[C@]12CCC[C@@]3(CO3)[C@H]1C[C@@H]1[C@@H](C2)OC(=O)[C@@H]1CN1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H34ClNO4/c1-24-7-2-8-26(16-31-26)22(24)13-19-20(23(29)32-21(19)14-24)15-28-11-9-25(30,10-12-28)17-3-5-18(27)6-4-17/h3-6,19-22,30H,2,7-16H2,1H3/t19-,20+,21+,22-,24+,26+/m0/s1 |
| InChIKey | ZUVFLFLCXSNTLA-UJSCZAKOSA-N |
| XLogP | 4.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|