C28H38N2O3 — CID 4839338
8a-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 4839338) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 8a-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | 8a-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 4839338 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 8a-methyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | CC12CCCC3(CO3)C1CC1C(C2)OC(=O)C1CN1CCN(CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H38N2O3/c1-27-10-6-11-28(20-32-28)25(27)17-22-23(26(31)33-24(22)18-27)19-30-15-13-29(14-16-30)12-5-9-21-7-3-2-4-8-21/h2-5,7-9,22-25H,6,10-20H2,1H3 |
| InChIKey | ROHRUTAYOFATLK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|