C25H26N2O3 — CID 124867371
(1R,5R,6S,7R)-4-oxo-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 124867371) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is (1R,5R,6S,7R)-4-oxo-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1R,5R,6S,7R)-4-oxo-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 124867371 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (1R,5R,6S,7R)-4-oxo-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)[C@H]1[C@H]2C(=O)N(c3ccccc3)C[C@@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C25H26N2O3/c1-17(12-13-18-8-4-2-5-9-18)26-23(28)21-20-14-15-25(30-20)16-27(24(29)22(21)25)19-10-6-3-7-11-19/h2-11,14-15,17,20-22H,12-13,16H2,1H3,(H,26,28)/t17-,20-,21-,22+,25+/m1/s1 |
| InChIKey | DOQJCMSPVWOHSQ-PLNGWDEDSA-N |
| XLogP | 3.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|