C26H26N2O5 — CID 51446368
(1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-4-oxo-N-[(2S)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 51446368) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-4-oxo-N-[(2S)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-4-oxo-N-[(2S)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 51446368 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-4-oxo-N-[(2S)-4-phenylbutan-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)[C@@H]1[C@H]2C(=O)N(c3ccc4c(c3)OCO4)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C26H26N2O5/c1-16(7-8-17-5-3-2-4-6-17)27-24(29)22-20-11-12-26(33-20)14-28(25(30)23(22)26)18-9-10-19-21(13-18)32-15-31-19/h2-6,9-13,16,20,22-23H,7-8,14-15H2,1H3,(H,27,29)/t16-,20+,22-,23-,26+/m0/s1 |
| InChIKey | ODIVOGBZXBNPLY-WTVUKVQKSA-N |
| XLogP | 2.84 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|