C20H22N2O7 — CID 51523203
(1S,5S,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 51523203) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is (1S,5S,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1S,5S,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 51523203 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (1S,5S,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | COC(CNC(=O)[C@H]1[C@H]2C=C[C@]3(CN(c4ccc5c(c4)OCO5)C(=O)[C@@H]13)O2)OC |
| InChI | InChI=1S/C20H22N2O7/c1-25-15(26-2)8-21-18(23)16-13-5-6-20(29-13)9-22(19(24)17(16)20)11-3-4-12-14(7-11)28-10-27-12/h3-7,13,15-17H,8-10H2,1-2H3,(H,21,23)/t13-,16+,17-,20-/m1/s1 |
| InChIKey | UBDMSVQMWZTODT-IULIOSHDSA-N |
| XLogP | 0.44 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|