C19H20N2O6 — CID 40854640
(1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 40854640) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is (1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 40854640 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (1S,5R,6R,7R)-3-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | O=C(NCCCO)[C@@H]1[C@H]2C(=O)N(c3ccc4c(c3)OCO4)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C19H20N2O6/c22-7-1-6-20-17(23)15-13-4-5-19(27-13)9-21(18(24)16(15)19)11-2-3-12-14(8-11)26-10-25-12/h2-5,8,13,15-16,22H,1,6-7,9-10H2,(H,20,23)/t13-,15+,16+,19-/m1/s1 |
| InChIKey | QBNLHAMXLJITFZ-FVQSIRDASA-N |
| XLogP | 0.20 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|