C17H17ClN2O4 — CID 176525362
(1S,7R)-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 176525362) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is (1S,7R)-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1S,7R)-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 176525362 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (1S,7R)-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | O=C(NCCO)C1C2C(=O)N(c3ccc(Cl)cc3)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C17H17ClN2O4/c18-10-1-3-11(4-2-10)20-9-17-6-5-12(24-17)13(14(17)16(20)23)15(22)19-7-8-21/h1-6,12-14,21H,7-9H2,(H,19,22)/t12-,13?,14?,17-/m1/s1 |
| InChIKey | SBHBVMPURYPDRP-QROZZAMVSA-N |
| XLogP | 0.73 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|