C25H30O2 — CID 124867485
cis-(2R,6S)-2-[[(1R,3E)-3-benzylidene-2-oxocyclopentyl]methyl]-6-(cyclohexen-1-yl)cyclohexan-1-one (PubChem CID 124867485) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is cis-(2R,6S)-2-[[(1R,3E)-3-benzylidene-2-oxocyclopentyl]methyl]-6-(cyclohexen-1-yl)cyclohexan-1-one.
| Compound Name | cis-(2R,6S)-2-[[(1R,3E)-3-benzylidene-2-oxocyclopentyl]methyl]-6-(cyclohexen-1-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 124867485 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | cis-(2R,6S)-2-[[(1R,3E)-3-benzylidene-2-oxocyclopentyl]methyl]-6-(cyclohexen-1-yl)cyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccccc2)CC[C@@H]1C[C@H]1CCC[C@@H](C2=CCCCC2)C1=O |
| InChI | InChI=1S/C25H30O2/c26-24-21(16-18-8-3-1-4-9-18)14-15-22(24)17-20-12-7-13-23(25(20)27)19-10-5-2-6-11-19/h1,3-4,8-10,16,20,22-23H,2,5-7,11-15,17H2/b21-16+/t20-,22-,23+/m1/s1 |
| InChIKey | HWZZEAVSPCVWGA-PAMVQMSOSA-N |
| XLogP | 5.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|