C32H34O2 — CID 163063535
(2R,3R,8S)-5'-benzylidene-8-(cyclohexen-1-yl)-2-phenylspiro[2,4,5,6,7,8-hexahydrochromene-3,2'-cyclopentane]-1'-one (PubChem CID 163063535) has the molecular formula C32H34O2 and a molecular weight of 450.62 g/mol. Its IUPAC name is (2R,3R,8S)-5'-benzylidene-8-(cyclohexen-1-yl)-2-phenylspiro[2,4,5,6,7,8-hexahydrochromene-3,2'-cyclopentane]-1'-one.
| Compound Name | (2R,3R,8S)-5'-benzylidene-8-(cyclohexen-1-yl)-2-phenylspiro[2,4,5,6,7,8-hexahydrochromene-3,2'-cyclopentane]-1'-one |
|---|---|
| PubChem CID | 163063535 |
| Molecular Formula | C32H34O2 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (2R,3R,8S)-5'-benzylidene-8-(cyclohexen-1-yl)-2-phenylspiro[2,4,5,6,7,8-hexahydrochromene-3,2'-cyclopentane]-1'-one |
| SMILES | O=C1C(=Cc2ccccc2)CC[C@]12CC1=C(O[C@@H]2c2ccccc2)[C@H](C2=CCCCC2)CCC1 |
| InChI | InChI=1S/C32H34O2/c33-30-26(21-23-11-4-1-5-12-23)19-20-32(30)22-27-17-10-18-28(24-13-6-2-7-14-24)29(27)34-31(32)25-15-8-3-9-16-25/h1,3-5,8-9,11-13,15-16,21,28,31H,2,6-7,10,14,17-20,22H2/t28-,31+,32-/m0/s1 |
| InChIKey | CEWFKTJMXFUPQH-YXQUNVLPSA-N |
| XLogP | 8.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|