C15H17N3O3 — CID 124868559
5-[(4aS,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-nitrobenzonitrile (PubChem CID 124868559) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-[(4aS,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-nitrobenzonitrile.
| Compound Name | 5-[(4aS,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 124868559 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 5-[(4aS,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-2-nitrobenzonitrile |
| SMILES | N#Cc1cc(N2CC[C@H]3OCCC[C@H]3C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O3/c16-9-12-8-13(3-4-14(12)18(19)20)17-6-5-15-11(10-17)2-1-7-21-15/h3-4,8,11,15H,1-2,5-7,10H2/t11-,15+/m0/s1 |
| InChIKey | MAPZUZBHRDQGMX-XHDPSFHLSA-N |
| XLogP | 2.47 |
| TPSA | 79.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|