C13H16FN3O — CID 124869145
(1R,4S,7S)-2-(5-fluoropyrimidin-2-yl)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptane (PubChem CID 124869145) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is (1R,4S,7S)-2-(5-fluoropyrimidin-2-yl)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S,7S)-2-(5-fluoropyrimidin-2-yl)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 124869145 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (1R,4S,7S)-2-(5-fluoropyrimidin-2-yl)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptane |
| SMILES | C=CCO[C@H]1[C@H]2CC[C@H]1N(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C13H16FN3O/c1-2-5-18-12-9-3-4-11(12)17(8-9)13-15-6-10(14)7-16-13/h2,6-7,9,11-12H,1,3-5,8H2/t9-,11+,12-/m0/s1 |
| InChIKey | GGTMXLINXXEPIF-WCQGTBRESA-N |
| XLogP | 1.79 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|