C16H23FN4O — CID 98776801
(3S)-8-(5-fluoropyrimidin-2-yl)-3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decane (PubChem CID 98776801) has the molecular formula C16H23FN4O and a molecular weight of 306.38 g/mol. Its IUPAC name is (3S)-8-(5-fluoropyrimidin-2-yl)-3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3S)-8-(5-fluoropyrimidin-2-yl)-3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 98776801 |
| Molecular Formula | C16H23FN4O |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (3S)-8-(5-fluoropyrimidin-2-yl)-3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decane |
| SMILES | Fc1cnc(N2CCC3(CC2)C[C@H](N2CCCC2)CO3)nc1 |
| InChI | InChI=1S/C16H23FN4O/c17-13-10-18-15(19-11-13)21-7-3-16(4-8-21)9-14(12-22-16)20-5-1-2-6-20/h10-11,14H,1-9,12H2/t14-/m0/s1 |
| InChIKey | UVRMLSLXOPJSMP-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |