C15H24FN5O — CID 125184210
2-[[(7R,8aR)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]oxy]-N,N-dimethylethanamine (PubChem CID 125184210) has the molecular formula C15H24FN5O and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[[(7R,8aR)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[(7R,8aR)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 125184210 |
| Molecular Formula | C15H24FN5O |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 2-[[(7R,8aR)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCO[C@@H]1C[C@@H]2CN(c3ncc(F)cn3)CCN2C1 |
| InChI | InChI=1S/C15H24FN5O/c1-19(2)5-6-22-14-7-13-10-21(4-3-20(13)11-14)15-17-8-12(16)9-18-15/h8-9,13-14H,3-7,10-11H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | ADWURQGPFUTFJP-ZIAGYGMSSA-N |
| XLogP | 0.46 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |