C24H31N3O3 — CID 124869417
(2R)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[2-(piperidin-1-ylmethyl)phenyl]propanamide (PubChem CID 124869417) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2R)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[2-(piperidin-1-ylmethyl)phenyl]propanamide.
| Compound Name | (2R)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[2-(piperidin-1-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 124869417 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (2R)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[2-(piperidin-1-ylmethyl)phenyl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1CN1CCCCC1)N1C(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C24H31N3O3/c1-15(27-23(29)20-16-9-10-17(13-16)21(20)24(27)30)22(28)25-19-8-4-3-7-18(19)14-26-11-5-2-6-12-26/h3-4,7-8,15-17,20-21H,2,5-6,9-14H2,1H3,(H,25,28)/t15-,16+,17+,20-,21+/m1/s1 |
| InChIKey | PBURPTYVIMFIBE-COPBIKPMSA-N |
| XLogP | 3.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|