C16H22F3NO3 — CID 124872005
(2S)-2-(2-ethoxyethoxy)-N-ethyl-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 124872005) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (2S)-2-(2-ethoxyethoxy)-N-ethyl-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-(2-ethoxyethoxy)-N-ethyl-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 124872005 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2S)-2-(2-ethoxyethoxy)-N-ethyl-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCOCCO[C@@H](C)C(=O)N(CC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3NO3/c1-4-20(15(21)12(3)23-11-10-22-5-2)14-8-6-13(7-9-14)16(17,18)19/h6-9,12H,4-5,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | VIEOZCMSJQEAKF-LBPRGKRZSA-N |
| XLogP | 3.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|