C14H24N4OS — CID 124872272
N-[3-[methyl-[(1S)-1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]amino]propyl]cyclobutanecarboxamide (PubChem CID 124872272) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is N-[3-[methyl-[(1S)-1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[methyl-[(1S)-1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 124872272 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[3-[methyl-[(1S)-1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]amino]propyl]cyclobutanecarboxamide |
| SMILES | Cc1nnc([C@H](C)N(C)CCCNC(=O)C2CCC2)s1 |
| InChI | InChI=1S/C14H24N4OS/c1-10(14-17-16-11(2)20-14)18(3)9-5-8-15-13(19)12-6-4-7-12/h10,12H,4-9H2,1-3H3,(H,15,19)/t10-/m0/s1 |
| InChIKey | KISZITLBFZQDFT-JTQLQIEISA-N |
| XLogP | 2.15 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|