C14H28N4O — CID 124873320
(9aR)-6,6,8-trimethyl-N-propan-2-yl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 124873320) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is (9aR)-6,6,8-trimethyl-N-propan-2-yl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (9aR)-6,6,8-trimethyl-N-propan-2-yl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 124873320 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | (9aR)-6,6,8-trimethyl-N-propan-2-yl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC(C)NC(=O)N1CCN2[C@H](CN(C)CC2(C)C)C1 |
| InChI | InChI=1S/C14H28N4O/c1-11(2)15-13(19)17-6-7-18-12(9-17)8-16(5)10-14(18,3)4/h11-12H,6-10H2,1-5H3,(H,15,19)/t12-/m1/s1 |
| InChIKey | ARSZFELVOXQWDT-GFCCVEGCSA-N |
| XLogP | 0.81 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |