C17H34N4O — CID 50955756
8-methyl-N-(2,4,4-trimethylpentan-2-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 50955756) has the molecular formula C17H34N4O and a molecular weight of 310.49 g/mol. Its IUPAC name is 8-methyl-N-(2,4,4-trimethylpentan-2-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 8-methyl-N-(2,4,4-trimethylpentan-2-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 50955756 |
| Molecular Formula | C17H34N4O |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 8-methyl-N-(2,4,4-trimethylpentan-2-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CN1CCN2CCN(C(=O)NC(C)(C)CC(C)(C)C)CC2C1 |
| InChI | InChI=1S/C17H34N4O/c1-16(2,3)13-17(4,5)18-15(22)21-10-9-20-8-7-19(6)11-14(20)12-21/h14H,7-13H2,1-6H3,(H,18,22) |
| InChIKey | URBIXIHKJSYMRC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |