C17H26N2O3S — CID 124874318
methyl (2R)-2-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-thiophen-3-ylacetate (PubChem CID 124874318) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is methyl (2R)-2-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-thiophen-3-ylacetate.
| Compound Name | methyl (2R)-2-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 124874318 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl (2R)-2-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-thiophen-3-ylacetate |
| SMILES | COC(=O)[C@@H](c1ccsc1)N1CCCC[C@@H]1CN1CCOCC1 |
| InChI | InChI=1S/C17H26N2O3S/c1-21-17(20)16(14-5-11-23-13-14)19-6-3-2-4-15(19)12-18-7-9-22-10-8-18/h5,11,13,15-16H,2-4,6-10,12H2,1H3/t15-,16-/m1/s1 |
| InChIKey | BJPRTZVZIAVYKD-HZPDHXFCSA-N |
| XLogP | 2.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |