C15H16N4O3S — CID 124874989
N-[2-methyl-4-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]oxyphenyl]thiadiazole-5-carboxamide (PubChem CID 124874989) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is N-[2-methyl-4-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]oxyphenyl]thiadiazole-5-carboxamide.
| Compound Name | N-[2-methyl-4-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]oxyphenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 124874989 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-[2-methyl-4-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]oxyphenyl]thiadiazole-5-carboxamide |
| SMILES | Cc1cc(O[C@@H]2CCN(C)C2=O)ccc1NC(=O)c1cnns1 |
| InChI | InChI=1S/C15H16N4O3S/c1-9-7-10(22-12-5-6-19(2)15(12)21)3-4-11(9)17-14(20)13-8-16-18-23-13/h3-4,7-8,12H,5-6H2,1-2H3,(H,17,20)/t12-/m1/s1 |
| InChIKey | ICRCMZYFBFZYAY-GFCCVEGCSA-N |
| XLogP | 1.71 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |