C21H18N2O3S — CID 23350553
N-[4-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-methylphenyl]thiophene-2-carboxamide (PubChem CID 23350553) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[4-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-methylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-methylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23350553 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[4-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-methylphenyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@@H]3C2)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C21H18N2O3S/c1-11-9-14(6-7-15(11)22-19(24)16-3-2-8-27-16)23-20(25)17-12-4-5-13(10-12)18(17)21(23)26/h2-9,12-13,17-18H,10H2,1H3,(H,22,24)/t12-,13-,17-,18+/m1/s1 |
| InChIKey | CNQOXUFZGNKQCS-HLNSBACISA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|