About N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide
N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide (PubChem CID 124877056) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide |
| PubChem CID | 124877056 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide |
| SMILES | C[C@H](O)c1ncc(C(=O)Nc2cccc(Nc3ccccc3)c2)s1 |
| InChI | InChI=1S/C18H17N3O2S/c1-12(22)18-19-11-16(24-18)17(23)21-15-9-5-8-14(10-15)20-13-6-3-2-4-7-13/h2-12,20,22H,1H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | ILBSJTZTJDPWJG-LBPRGKRZSA-N |
| XLogP | 4.19 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide (CID 124877056) is N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide is C[C@H](O)c1ncc(C(=O)Nc2cccc(Nc3ccccc3)c2)s1.
What is the InChIKey of N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide?
The InChIKey is ILBSJTZTJDPWJG-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H17N3O2S/c1-12(22)18-19-11-16(24-18)17(23)21-15-9-5-8-14(10-15)20-13-6-3-2-4-7-13/h2-12,20,22H,1H3,(H,21,23)/t12-/m0/s1.
What are the key properties of N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide?
N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide has a molecular weight of 339.42 g/mol, XLogP of 4.19, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-anilinophenyl)-2-[(1S)-1-hydroxyethyl]-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 124877056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).