C14H14N2O2S — CID 47425777
N-(3-acetylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide (PubChem CID 47425777) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 47425777 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(3-acetylphenyl)-2-ethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)Nc2cccc(C(C)=O)c2)s1 |
| InChI | InChI=1S/C14H14N2O2S/c1-3-13-15-8-12(19-13)14(18)16-11-6-4-5-10(7-11)9(2)17/h4-8H,3H2,1-2H3,(H,16,18) |
| InChIKey | HCPCOSSLTRAYKF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |